C14H17NO — CID 173064820
3-(5-methoxy-2-methylphenyl)-2,4-dimethyl-1H-pyrrole (PubChem CID 173064820) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(5-methoxy-2-methylphenyl)-2,4-dimethyl-1H-pyrrole.
| Compound Name | 3-(5-methoxy-2-methylphenyl)-2,4-dimethyl-1H-pyrrole |
|---|---|
| PubChem CID | 173064820 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(5-methoxy-2-methylphenyl)-2,4-dimethyl-1H-pyrrole |
| SMILES | COc1ccc(C)c(-c2c(C)c[nH]c2C)c1 |
| InChI | InChI=1S/C14H17NO/c1-9-5-6-12(16-4)7-13(9)14-10(2)8-15-11(14)3/h5-8,15H,1-4H3 |
| InChIKey | VTNXXFRRPKFPDH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |