C8H20ClNSi — CID 173065106
2-chloro-N,4-dimethyl-3-silylhexan-3-amine (PubChem CID 173065106) has the molecular formula C8H20ClNSi and a molecular weight of 193.79 g/mol. Its IUPAC name is 2-chloro-N,4-dimethyl-3-silylhexan-3-amine.
| Compound Name | 2-chloro-N,4-dimethyl-3-silylhexan-3-amine |
|---|---|
| PubChem CID | 173065106 |
| Molecular Formula | C8H20ClNSi |
| Molecular Weight | 193.79 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-chloro-N,4-dimethyl-3-silylhexan-3-amine |
| SMILES | CCC(C)C([SiH3])(NC)C(C)Cl |
| InChI | InChI=1S/C8H20ClNSi/c1-5-6(2)8(11,10-4)7(3)9/h6-7,10H,5H2,1-4,11H3 |
| InChIKey | JJRCEIGGPIUYMV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.79 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|