C21H19N3O3 — CID 173074385
5-(2,4-dimethoxyphenyl)-3-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)-1,2,4-oxadiazole (PubChem CID 173074385) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-3-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,4-dimethoxyphenyl)-3-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 173074385 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-3-(1,2,3,4-tetrahydrocyclopenta[b]indol-7-yl)-1,2,4-oxadiazole |
| SMILES | COc1ccc(-c2nc(-c3ccc4[nH]c5c(c4c3)CCC5)no2)c(OC)c1 |
| InChI | InChI=1S/C21H19N3O3/c1-25-13-7-8-15(19(11-13)26-2)21-23-20(24-27-21)12-6-9-18-16(10-12)14-4-3-5-17(14)22-18/h6-11,22H,3-5H2,1-2H3 |
| InChIKey | NVRHZFTZKGZKFX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|