C16H10N2S3 — CID 173112699
4-phenylsulfanyl-5-thiophen-2-yl-1,2,3-benzothiadiazole (PubChem CID 173112699) has the molecular formula C16H10N2S3 and a molecular weight of 326.47 g/mol. Its IUPAC name is 4-phenylsulfanyl-5-thiophen-2-yl-1,2,3-benzothiadiazole.
| Compound Name | 4-phenylsulfanyl-5-thiophen-2-yl-1,2,3-benzothiadiazole |
|---|---|
| PubChem CID | 173112699 |
| Molecular Formula | C16H10N2S3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 4-phenylsulfanyl-5-thiophen-2-yl-1,2,3-benzothiadiazole |
| SMILES | c1ccc(Sc2c(-c3cccs3)ccc3snnc23)cc1 |
| InChI | InChI=1S/C16H10N2S3/c1-2-5-11(6-3-1)20-16-12(13-7-4-10-19-13)8-9-14-15(16)17-18-21-14/h1-10H |
| InChIKey | ZVMQVGLTGVKOBI-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |