C14H7FN2S3 — CID 141278365
4-fluoro-5,6-dithiophen-2-yl-1,2,3-benzothiadiazole (PubChem CID 141278365) has the molecular formula C14H7FN2S3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-fluoro-5,6-dithiophen-2-yl-1,2,3-benzothiadiazole.
| Compound Name | 4-fluoro-5,6-dithiophen-2-yl-1,2,3-benzothiadiazole |
|---|---|
| PubChem CID | 141278365 |
| Molecular Formula | C14H7FN2S3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 4-fluoro-5,6-dithiophen-2-yl-1,2,3-benzothiadiazole |
| SMILES | Fc1c(-c2cccs2)c(-c2cccs2)cc2snnc12 |
| InChI | InChI=1S/C14H7FN2S3/c15-13-12(10-4-2-6-19-10)8(9-3-1-5-18-9)7-11-14(13)16-17-20-11/h1-7H |
| InChIKey | FVZRTALVBWZUMX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |