About CID 173132710
CID 173132710 (PubChem CID 173132710) has the molecular formula C14H21Se
and a molecular weight of 268.28 g/mol.
Molecular Properties
| Compound Name | CID 173132710 |
| PubChem CID | 173132710 |
| Molecular Formula | C14H21Se |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | — |
| SMILES | CCCCCCCCc1ccccc1[Se] |
| InChI | InChI=1S/C14H21Se/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15/h8-9,11-12H,2-7,10H2,1H3 |
| InChIKey | MFEJHOLXEWYHDL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173132710 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173132710?
The IUPAC name of CID 173132710 (CID 173132710) is not available.
What is the SMILES notation for CID 173132710?
The canonical SMILES for CID 173132710 is CCCCCCCCc1ccccc1[Se].
What is the InChIKey of CID 173132710?
The InChIKey is MFEJHOLXEWYHDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Se/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15/h8-9,11-12H,2-7,10H2,1H3.
What are the key properties of CID 173132710?
CID 173132710 has a molecular weight of 268.28 g/mol, XLogP of 3.38, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173132710 is sourced from PubChem (CID 173132710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).