About CID 173133116
CID 173133116 (PubChem CID 173133116) has the molecular formula C20H33Se
and a molecular weight of 352.44 g/mol.
Molecular Properties
| Compound Name | CID 173133116 |
| PubChem CID | 173133116 |
| Molecular Formula | C20H33Se |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | — |
| SMILES | CCCCCCCCCCCCCCc1ccccc1[Se] |
| InChI | InChI=1S/C20H33Se/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18-20(19)21/h14-15,17-18H,2-13,16H2,1H3 |
| InChIKey | AFXCPXOHKLTDSD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173133116 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173133116?
The IUPAC name of CID 173133116 (CID 173133116) is not available.
What is the SMILES notation for CID 173133116?
The canonical SMILES for CID 173133116 is CCCCCCCCCCCCCCc1ccccc1[Se].
What is the InChIKey of CID 173133116?
The InChIKey is AFXCPXOHKLTDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33Se/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-19-17-14-15-18-20(19)21/h14-15,17-18H,2-13,16H2,1H3.
What are the key properties of CID 173133116?
CID 173133116 has a molecular weight of 352.44 g/mol, XLogP of 5.72, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173133116 is sourced from PubChem (CID 173133116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).