C13H12Cl2FNO4 — CID 173133458
ethyl 3-[3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-oxopropoxy]prop-2-enoate (PubChem CID 173133458) has the molecular formula C13H12Cl2FNO4 and a molecular weight of 336.15 g/mol. Its IUPAC name is ethyl 3-[3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-oxopropoxy]prop-2-enoate.
| Compound Name | ethyl 3-[3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-oxopropoxy]prop-2-enoate |
|---|---|
| PubChem CID | 173133458 |
| Molecular Formula | C13H12Cl2FNO4 |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | ethyl 3-[3-(2,6-dichloro-5-fluoro-3-pyridinyl)-3-oxopropoxy]prop-2-enoate |
| SMILES | CCOC(=O)C=COCCC(=O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C13H12Cl2FNO4/c1-2-21-11(19)4-6-20-5-3-10(18)8-7-9(16)13(15)17-12(8)14/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | XVUPQLDVGLEOPQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|