C50H70N3O6+ — CID 173134541
2-[4-[2-[4-[4-(4-tert-butylanilino)phenoxy]-6-methoxyquinolin-7-yl]oxyethyl]morpholin-4-ium-4-yl]octadec-9-enoic acid (PubChem CID 173134541) has the molecular formula C50H70N3O6+ and a molecular weight of 809.12 g/mol. Its IUPAC name is 2-[4-[2-[4-[4-(4-tert-butylanilino)phenoxy]-6-methoxyquinolin-7-yl]oxyethyl]morpholin-4-ium-4-yl]octadec-9-enoic acid.
| Compound Name | 2-[4-[2-[4-[4-(4-tert-butylanilino)phenoxy]-6-methoxyquinolin-7-yl]oxyethyl]morpholin-4-ium-4-yl]octadec-9-enoic acid |
|---|---|
| PubChem CID | 173134541 |
| Molecular Formula | C50H70N3O6+ |
| Molecular Weight | 809.12 g/mol |
| Exact Mass | 808.53 |
| IUPAC Name | 2-[4-[2-[4-[4-(4-tert-butylanilino)phenoxy]-6-methoxyquinolin-7-yl]oxyethyl]morpholin-4-ium-4-yl]octadec-9-enoic acid |
| SMILES | CCCCCCCCC=CCCCCCCC(C(=O)O)[N+]1(CCOc2cc3nccc(Oc4ccc(Nc5ccc(C(C)(C)C)cc5)cc4)c3cc2OC)CCOCC1 |
| InChI | InChI=1S/C50H69N3O6/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-45(49(54)55)53(31-34-57-35-32-53)33-36-58-48-38-44-43(37-47(48)56-5)46(29-30-51-44)59-42-27-25-41(26-28-42)52-40-23-21-39(22-24-40)50(2,3)4/h13-14,21-30,37-38,45,52H,6-12,15-20,31-36H2,1-5H3/p+1 |
| InChIKey | WPQKKFWCYZMLOM-UHFFFAOYSA-O |
| XLogP | 12.40 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.12 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|