C21H28F3N3O3S — CID 173134942
tert-butyl-[[(1R)-1-(8-oxamoyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethyl]amino]-oxidosulfanium (PubChem CID 173134942) has the molecular formula C21H28F3N3O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is tert-butyl-[[(1R)-1-(8-oxamoyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethyl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(1R)-1-(8-oxamoyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethyl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 173134942 |
| Molecular Formula | C21H28F3N3O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | tert-butyl-[[(1R)-1-(8-oxamoyl-8-azabicyclo[3.2.1]octan-3-yl)-2-(2,4,5-trifluorophenyl)ethyl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)C(N)=O |
| InChI | InChI=1S/C21H28F3N3O3S/c1-21(2,3)31(30)26-18(9-11-8-16(23)17(24)10-15(11)22)12-6-13-4-5-14(7-12)27(13)20(29)19(25)28/h8,10,12-14,18,26H,4-7,9H2,1-3H3,(H2,25,28)/t12?,13?,14?,18-,31?/m1/s1 |
| InChIKey | JESNIDRWMRIXCT-XDPRVXFMSA-N |
| XLogP | 2.32 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|