C29H35N2NaO8S3 — CID 173135019
sodium;3-[2-[4-(1,1-dihydroxy-3-oxo-1-benzothiophen-2-ylidene)but-2-enylidene]-5-[[2-(2-hydroxyethylsulfanyl)acetyl]amino]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid;hydride (PubChem CID 173135019) has the molecular formula C29H35N2NaO8S3 and a molecular weight of 658.80 g/mol. Its IUPAC name is sodium;3-[2-[4-(1,1-dihydroxy-3-oxo-1-benzothiophen-2-ylidene)but-2-enylidene]-5-[[2-(2-hydroxyethylsulfanyl)acetyl]amino]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid;hydride.
| Compound Name | sodium;3-[2-[4-(1,1-dihydroxy-3-oxo-1-benzothiophen-2-ylidene)but-2-enylidene]-5-[[2-(2-hydroxyethylsulfanyl)acetyl]amino]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173135019 |
| Molecular Formula | C29H35N2NaO8S3 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | sodium;3-[2-[4-(1,1-dihydroxy-3-oxo-1-benzothiophen-2-ylidene)but-2-enylidene]-5-[[2-(2-hydroxyethylsulfanyl)acetyl]amino]-3,3-dimethylindol-1-yl]propane-1-sulfonic acid;hydride |
| SMILES | CC1(C)C(=CC=CC=C2C(=O)c3ccccc3S2(O)O)N(CCCS(=O)(=O)O)c2ccc(NC(=O)CSCCO)cc21.[H-].[Na+] |
| InChI | InChI=1S/C29H34N2O8S3.Na.H/c1-29(2)22-18-20(30-27(33)19-40-16-15-32)12-13-23(22)31(14-7-17-41(35,36)37)26(29)11-6-5-10-25-28(34)21-8-3-4-9-24(21)42(25,38)39;;/h3-6,8-13,18,32,38-39H,7,14-17,19H2,1-2H3,(H,30,33)(H,35,36,37);;/q;+1;-1 |
| InChIKey | SMNATMMYYREFJG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 164.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|