C25H25NO5S2 — CID 89289401
(2E)-3,3-dimethyl-1-propyl-2-[(E,4Z)-4-(1,1,3-trioxo-1-benzothiophen-2-ylidene)but-2-enylidene]indole-5-sulfinic acid (PubChem CID 89289401) has the molecular formula C25H25NO5S2 and a molecular weight of 483.61 g/mol. Its IUPAC name is (2E)-3,3-dimethyl-1-propyl-2-[(E,4Z)-4-(1,1,3-trioxo-1-benzothiophen-2-ylidene)but-2-enylidene]indole-5-sulfinic acid.
| Compound Name | (2E)-3,3-dimethyl-1-propyl-2-[(E,4Z)-4-(1,1,3-trioxo-1-benzothiophen-2-ylidene)but-2-enylidene]indole-5-sulfinic acid |
|---|---|
| PubChem CID | 89289401 |
| Molecular Formula | C25H25NO5S2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | (2E)-3,3-dimethyl-1-propyl-2-[(E,4Z)-4-(1,1,3-trioxo-1-benzothiophen-2-ylidene)but-2-enylidene]indole-5-sulfinic acid |
| SMILES | CCCN1/C(=C/C=C/C=C2/C(=O)c3ccccc3S2(=O)=O)C(C)(C)c2cc(S(=O)O)ccc21 |
| InChI | InChI=1S/C25H25NO5S2/c1-4-15-26-20-14-13-17(32(28)29)16-19(20)25(2,3)23(26)12-8-7-11-22-24(27)18-9-5-6-10-21(18)33(22,30)31/h5-14,16H,4,15H2,1-3H3,(H,28,29)/b8-7+,22-11-,23-12+ |
| InChIKey | PMADDTUAJMAXQY-KLPCMQQESA-N |
| XLogP | 4.77 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|