C26H23NaO10 — CID 173139491
sodium;hydride;[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 173139491) has the molecular formula C26H23NaO10 and a molecular weight of 518.45 g/mol. Its IUPAC name is sodium;hydride;[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | sodium;hydride;[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 173139491 |
| Molecular Formula | C26H23NaO10 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | sodium;hydride;[4-[1-(4-hydroxyphenyl)-3-oxo-2-benzofuran-1-yl]phenyl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2ccc(OC(=O)[C@H]3O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]3O)cc2)c2ccccc21.[H-].[Na+] |
| InChI | InChI=1S/C26H22O10.Na.H/c27-15-9-5-13(6-10-15)26(18-4-2-1-3-17(18)23(31)36-26)14-7-11-16(12-8-14)34-25(33)22-20(29)19(28)21(30)24(32)35-22;;/h1-12,19-22,24,27-30,32H;;/q;+1;-1/t19-,20-,21+,22-,24+,26?;;/m0../s1 |
| InChIKey | CLSBEKQEMSGUFR-HVOPISKKSA-N |
| XLogP | -2.32 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|