C12H14O8 — CID 68555875
(4-hydroxyphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 68555875) has the molecular formula C12H14O8 and a molecular weight of 286.24 g/mol. Its IUPAC name is (4-hydroxyphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | (4-hydroxyphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 68555875 |
| Molecular Formula | C12H14O8 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (4-hydroxyphenyl) (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | O=C(Oc1ccc(O)cc1)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14O8/c13-5-1-3-6(4-2-5)19-12(18)10-8(15)7(14)9(16)11(17)20-10/h1-4,7-11,13-17H/t7-,8-,9+,10-,11+/m0/s1 |
| InChIKey | WUIXFULZVSIWFG-QUARPLMYSA-N |
| XLogP | -1.90 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|