C16H18O4S — CID 173142300
3-(1-hydroxy-2-sulfanylbutylidene)-5-(2-phenylethyl)oxolane-2,4-dione (PubChem CID 173142300) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 3-(1-hydroxy-2-sulfanylbutylidene)-5-(2-phenylethyl)oxolane-2,4-dione.
| Compound Name | 3-(1-hydroxy-2-sulfanylbutylidene)-5-(2-phenylethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 173142300 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 3-(1-hydroxy-2-sulfanylbutylidene)-5-(2-phenylethyl)oxolane-2,4-dione |
| SMILES | CCC(S)C(O)=C1C(=O)OC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C16H18O4S/c1-2-12(21)15(18)13-14(17)11(20-16(13)19)9-8-10-6-4-3-5-7-10/h3-7,11-12,18,21H,2,8-9H2,1H3 |
| InChIKey | QTJDVSPLFWSDGH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|