C14H16N4O3S — CID 173143427
[(N'-anilinocarbamimidoyl)amino] 4-methylbenzenesulfonate (PubChem CID 173143427) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is [(N'-anilinocarbamimidoyl)amino] 4-methylbenzenesulfonate.
| Compound Name | [(N'-anilinocarbamimidoyl)amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173143427 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [(N'-anilinocarbamimidoyl)amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ONC(N)=NNc2ccccc2)cc1 |
| InChI | InChI=1S/C14H16N4O3S/c1-11-7-9-13(10-8-11)22(19,20)21-18-14(15)17-16-12-5-3-2-4-6-12/h2-10,16H,1H3,(H3,15,17,18) |
| InChIKey | VIFXDVHFFQQQBS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|