C18H20N4O3S — CID 176535441
[[N'-(3-phenylbut-1-enylideneamino)carbamimidoyl]amino] 4-methylbenzenesulfonate (PubChem CID 176535441) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is [[N'-(3-phenylbut-1-enylideneamino)carbamimidoyl]amino] 4-methylbenzenesulfonate.
| Compound Name | [[N'-(3-phenylbut-1-enylideneamino)carbamimidoyl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 176535441 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [[N'-(3-phenylbut-1-enylideneamino)carbamimidoyl]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ONC(N)=NN=C=CC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N4O3S/c1-14-8-10-17(11-9-14)26(23,24)25-22-18(19)21-20-13-12-15(2)16-6-4-3-5-7-16/h3-12,15H,1-2H3,(H3,19,21,22) |
| InChIKey | MNDHRVABCKVEBR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|