C15H19NO5S — CID 46845587
(2-methylhexa-4,5-dien-3-yloxycarbonylamino) 4-methylbenzenesulfonate (PubChem CID 46845587) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is (2-methylhexa-4,5-dien-3-yloxycarbonylamino) 4-methylbenzenesulfonate.
| Compound Name | (2-methylhexa-4,5-dien-3-yloxycarbonylamino) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46845587 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2-methylhexa-4,5-dien-3-yloxycarbonylamino) 4-methylbenzenesulfonate |
| SMILES | C=C=CC(OC(=O)NOS(=O)(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C15H19NO5S/c1-5-6-14(11(2)3)20-15(17)16-21-22(18,19)13-9-7-12(4)8-10-13/h6-11,14H,1H2,2-4H3,(H,16,17) |
| InChIKey | LBLDHIJMRPPTOS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|