C21H19NOS — CID 173175471
4,4-diphenyl-4-pyridin-4-yl-2-sulfanylbutanal (PubChem CID 173175471) has the molecular formula C21H19NOS and a molecular weight of 333.46 g/mol. Its IUPAC name is 4,4-diphenyl-4-pyridin-4-yl-2-sulfanylbutanal.
| Compound Name | 4,4-diphenyl-4-pyridin-4-yl-2-sulfanylbutanal |
|---|---|
| PubChem CID | 173175471 |
| Molecular Formula | C21H19NOS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4,4-diphenyl-4-pyridin-4-yl-2-sulfanylbutanal |
| SMILES | O=CC(S)CC(c1ccccc1)(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C21H19NOS/c23-16-20(24)15-21(17-7-3-1-4-8-17,18-9-5-2-6-10-18)19-11-13-22-14-12-19/h1-14,16,20,24H,15H2 |
| InChIKey | CFEDBQRKASSQGA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|