About 2-tridecan-2-yl-4H-1,4-oxazine
2-tridecan-2-yl-4H-1,4-oxazine (PubChem CID 173176718) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is 2-tridecan-2-yl-4H-1,4-oxazine.
Molecular Properties
| Compound Name | 2-tridecan-2-yl-4H-1,4-oxazine |
| PubChem CID | 173176718 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 2-tridecan-2-yl-4H-1,4-oxazine |
| SMILES | CCCCCCCCCCCC(C)C1=CNC=CO1 |
| InChI | InChI=1S/C17H31NO/c1-3-4-5-6-7-8-9-10-11-12-16(2)17-15-18-13-14-19-17/h13-16,18H,3-12H2,1-2H3 |
| InChIKey | CGAKYNPCMZZCRT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-tridecan-2-yl-4H-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tridecan-2-yl-4H-1,4-oxazine?
The IUPAC name of 2-tridecan-2-yl-4H-1,4-oxazine (CID 173176718) is 2-tridecan-2-yl-4H-1,4-oxazine.
What is the SMILES notation for 2-tridecan-2-yl-4H-1,4-oxazine?
The canonical SMILES for 2-tridecan-2-yl-4H-1,4-oxazine is CCCCCCCCCCCC(C)C1=CNC=CO1.
What is the InChIKey of 2-tridecan-2-yl-4H-1,4-oxazine?
The InChIKey is CGAKYNPCMZZCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO/c1-3-4-5-6-7-8-9-10-11-12-16(2)17-15-18-13-14-19-17/h13-16,18H,3-12H2,1-2H3.
What are the key properties of 2-tridecan-2-yl-4H-1,4-oxazine?
2-tridecan-2-yl-4H-1,4-oxazine has a molecular weight of 265.44 g/mol, XLogP of 5.48, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tridecan-2-yl-4H-1,4-oxazine is sourced from PubChem (CID 173176718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).