C10H20O7Si — CID 173193314
[1-carboxyoxy-4-[(2-methylpropan-2-yl)oxysilyl]butan-2-yl] hydrogen carbonate (PubChem CID 173193314) has the molecular formula C10H20O7Si and a molecular weight of 280.35 g/mol. Its IUPAC name is [1-carboxyoxy-4-[(2-methylpropan-2-yl)oxysilyl]butan-2-yl] hydrogen carbonate.
| Compound Name | [1-carboxyoxy-4-[(2-methylpropan-2-yl)oxysilyl]butan-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 173193314 |
| Molecular Formula | C10H20O7Si |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [1-carboxyoxy-4-[(2-methylpropan-2-yl)oxysilyl]butan-2-yl] hydrogen carbonate |
| SMILES | CC(C)(C)O[SiH2]CCC(COC(=O)O)OC(=O)O |
| InChI | InChI=1S/C10H20O7Si/c1-10(2,3)17-18-5-4-7(16-9(13)14)6-15-8(11)12/h7H,4-6,18H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | WUAQVKZOIKDCMB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|