C12H20N2O4 — CID 173195857
4-[1-[2,2-bis(2-hydroxyethyl)hydrazinyl]ethyl]benzene-1,2-diol (PubChem CID 173195857) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-[1-[2,2-bis(2-hydroxyethyl)hydrazinyl]ethyl]benzene-1,2-diol.
| Compound Name | 4-[1-[2,2-bis(2-hydroxyethyl)hydrazinyl]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 173195857 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-[1-[2,2-bis(2-hydroxyethyl)hydrazinyl]ethyl]benzene-1,2-diol |
| SMILES | CC(NN(CCO)CCO)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H20N2O4/c1-9(13-14(4-6-15)5-7-16)10-2-3-11(17)12(18)8-10/h2-3,8-9,13,15-18H,4-7H2,1H3 |
| InChIKey | OMPVPRBUCACPKU-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|