C22H38N2O5 — CID 173220962
4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-methylamino]-3-ethyl-2-methylhepta-2,6-dienoic acid (PubChem CID 173220962) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is 4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-methylamino]-3-ethyl-2-methylhepta-2,6-dienoic acid.
| Compound Name | 4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-methylamino]-3-ethyl-2-methylhepta-2,6-dienoic acid |
|---|---|
| PubChem CID | 173220962 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 4-[[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]-methylamino]-3-ethyl-2-methylhepta-2,6-dienoic acid |
| SMILES | C=CCC(C(CC)=C(C)C(=O)O)N(C)C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H38N2O5/c1-11-13-16(15(12-2)14(3)19(26)27)24(10)18(25)17(21(4,5)6)23-20(28)29-22(7,8)9/h11,16-17H,1,12-13H2,2-10H3,(H,23,28)(H,26,27)/t16?,17-/m1/s1 |
| InChIKey | JJAGNINEYCKHMQ-ZYMOGRSISA-N |
| XLogP | 4.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|