C7H14NNaO4S — CID 173229227
sodium;2-carbamoyl-3-methylpent-1-ene-1-sulfonic acid;hydride (PubChem CID 173229227) has the molecular formula C7H14NNaO4S and a molecular weight of 231.25 g/mol. Its IUPAC name is sodium;2-carbamoyl-3-methylpent-1-ene-1-sulfonic acid;hydride.
| Compound Name | sodium;2-carbamoyl-3-methylpent-1-ene-1-sulfonic acid;hydride |
|---|---|
| PubChem CID | 173229227 |
| Molecular Formula | C7H14NNaO4S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | sodium;2-carbamoyl-3-methylpent-1-ene-1-sulfonic acid;hydride |
| SMILES | CCC(C)C(=CS(=O)(=O)O)C(N)=O.[H-].[Na+] |
| InChI | InChI=1S/C7H13NO4S.Na.H/c1-3-5(2)6(7(8)9)4-13(10,11)12;;/h4-5H,3H2,1-2H3,(H2,8,9)(H,10,11,12);;/q;+1;-1 |
| InChIKey | SHDLALQCURVQFG-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|