C43H78N2O6 — CID 173237567
2,3-bis(octadec-9-enoylamino)-2-propylbutanedioic acid (PubChem CID 173237567) has the molecular formula C43H78N2O6 and a molecular weight of 719.11 g/mol. Its IUPAC name is 2,3-bis(octadec-9-enoylamino)-2-propylbutanedioic acid.
| Compound Name | 2,3-bis(octadec-9-enoylamino)-2-propylbutanedioic acid |
|---|---|
| PubChem CID | 173237567 |
| Molecular Formula | C43H78N2O6 |
| Molecular Weight | 719.11 g/mol |
| Exact Mass | 718.59 |
| IUPAC Name | 2,3-bis(octadec-9-enoylamino)-2-propylbutanedioic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(C(=O)O)C(CCC)(NC(=O)CCCCCCCC=CCCCCCCCC)C(=O)O |
| InChI | InChI=1S/C43H78N2O6/c1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38(46)44-40(41(48)49)43(37-6-3,42(50)51)45-39(47)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2/h19-22,40H,4-18,23-37H2,1-3H3,(H,44,46)(H,45,47)(H,48,49)(H,50,51) |
| InChIKey | YWCJQMCHWCWOQS-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.11 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|