C14H16O2Si — CID 173241984
2-cyclohexa-2,4-dien-1-yl-2-hydroxy-2-phenyl-1-silylethanone (PubChem CID 173241984) has the molecular formula C14H16O2Si and a molecular weight of 244.37 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-2-hydroxy-2-phenyl-1-silylethanone.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-2-hydroxy-2-phenyl-1-silylethanone |
|---|---|
| PubChem CID | 173241984 |
| Molecular Formula | C14H16O2Si |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-2-hydroxy-2-phenyl-1-silylethanone |
| SMILES | O=C([SiH3])C(O)(c1ccccc1)C1C=CC=CC1 |
| InChI | InChI=1S/C14H16O2Si/c15-13(17)14(16,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-9,12,16H,10H2,17H3 |
| InChIKey | MMEDWSABHJLMAL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|