C25H40N2O5P2 — CID 143079815
[12-[amino(hydroxy)phosphoryl]-2-cyclohexa-2,4-dien-1-yl-7-oxo-12-phenyltridecan-2-yl]phosphonamidic acid (PubChem CID 143079815) has the molecular formula C25H40N2O5P2 and a molecular weight of 510.55 g/mol. Its IUPAC name is [12-[amino(hydroxy)phosphoryl]-2-cyclohexa-2,4-dien-1-yl-7-oxo-12-phenyltridecan-2-yl]phosphonamidic acid.
| Compound Name | [12-[amino(hydroxy)phosphoryl]-2-cyclohexa-2,4-dien-1-yl-7-oxo-12-phenyltridecan-2-yl]phosphonamidic acid |
|---|---|
| PubChem CID | 143079815 |
| Molecular Formula | C25H40N2O5P2 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | [12-[amino(hydroxy)phosphoryl]-2-cyclohexa-2,4-dien-1-yl-7-oxo-12-phenyltridecan-2-yl]phosphonamidic acid |
| SMILES | CC(CCCCC(=O)CCCCC(C)(C1C=CC=CC1)P(N)(=O)O)(c1ccccc1)P(N)(=O)O |
| InChI | InChI=1S/C25H40N2O5P2/c1-24(33(26,29)30,21-13-5-3-6-14-21)19-11-9-17-23(28)18-10-12-20-25(2,34(27,31)32)22-15-7-4-8-16-22/h3-8,13-15,22H,9-12,16-20H2,1-2H3,(H3,26,29,30)(H3,27,31,32) |
| InChIKey | JWLMERMHLIBGKS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|