C7H10O4 — CID 173246012
3-[3-(hydroxymethyl)oxiran-2-yl]-2-methylprop-2-enoic acid (PubChem CID 173246012) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)oxiran-2-yl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[3-(hydroxymethyl)oxiran-2-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 173246012 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 3-[3-(hydroxymethyl)oxiran-2-yl]-2-methylprop-2-enoic acid |
| SMILES | CC(=CC1OC1CO)C(=O)O |
| InChI | InChI=1S/C7H10O4/c1-4(7(9)10)2-5-6(3-8)11-5/h2,5-6,8H,3H2,1H3,(H,9,10) |
| InChIKey | DNODQQULYGWJBK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|