C20H40N2O4Si — CID 173250381
tert-butyl (2R,3R)-3-tert-butyl-2-(tert-butylcarbamoyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 173250381) has the molecular formula C20H40N2O4Si and a molecular weight of 400.64 g/mol. Its IUPAC name is tert-butyl (2R,3R)-3-tert-butyl-2-(tert-butylcarbamoyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R)-3-tert-butyl-2-(tert-butylcarbamoyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 173250381 |
| Molecular Formula | C20H40N2O4Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | tert-butyl (2R,3R)-3-tert-butyl-2-(tert-butylcarbamoyl)-2-dimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | C[SiH](C)O[C@@]1(C(=O)NC(C)(C)C)[C@@H](C(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N2O4Si/c1-17(2,3)14-12-13-22(16(24)25-19(7,8)9)20(14,26-27(10)11)15(23)21-18(4,5)6/h14,27H,12-13H2,1-11H3,(H,21,23)/t14-,20-/m1/s1 |
| InChIKey | VBCKZCQXWCFPJI-JLTOFOAXSA-N |
| XLogP | 3.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|