C15H28O — CID 173251377
(2E,7E)-2,4,6-trimethyldodeca-2,7-dien-1-ol (PubChem CID 173251377) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (2E,7E)-2,4,6-trimethyldodeca-2,7-dien-1-ol.
| Compound Name | (2E,7E)-2,4,6-trimethyldodeca-2,7-dien-1-ol |
|---|---|
| PubChem CID | 173251377 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (2E,7E)-2,4,6-trimethyldodeca-2,7-dien-1-ol |
| SMILES | CCCC/C=C/C(C)CC(C)/C=C(\C)CO |
| InChI | InChI=1S/C15H28O/c1-5-6-7-8-9-13(2)10-14(3)11-15(4)12-16/h8-9,11,13-14,16H,5-7,10,12H2,1-4H3/b9-8+,15-11+ |
| InChIKey | YUDNVHBFMOJYQO-QCTDOKRBSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|