C29H28N4O3 — CID 173264410
3-[3-oxo-3-[2-(6-phenylmethoxy-1H-indol-2-yl)ethylamino]propyl]-1H-indole-2-carboxamide (PubChem CID 173264410) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3-[3-oxo-3-[2-(6-phenylmethoxy-1H-indol-2-yl)ethylamino]propyl]-1H-indole-2-carboxamide.
| Compound Name | 3-[3-oxo-3-[2-(6-phenylmethoxy-1H-indol-2-yl)ethylamino]propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 173264410 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-[3-oxo-3-[2-(6-phenylmethoxy-1H-indol-2-yl)ethylamino]propyl]-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1[nH]c2ccccc2c1CCC(=O)NCCc1cc2ccc(OCc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C29H28N4O3/c30-29(35)28-24(23-8-4-5-9-25(23)33-28)12-13-27(34)31-15-14-21-16-20-10-11-22(17-26(20)32-21)36-18-19-6-2-1-3-7-19/h1-11,16-17,32-33H,12-15,18H2,(H2,30,35)(H,31,34) |
| InChIKey | KIPFAJIEMIWNQD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|