C20H19NO — CID 173271409
3,6-dimethyl-2-(4-phenoxyphenyl)aniline (PubChem CID 173271409) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is 3,6-dimethyl-2-(4-phenoxyphenyl)aniline.
| Compound Name | 3,6-dimethyl-2-(4-phenoxyphenyl)aniline |
|---|---|
| PubChem CID | 173271409 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3,6-dimethyl-2-(4-phenoxyphenyl)aniline |
| SMILES | Cc1ccc(C)c(-c2ccc(Oc3ccccc3)cc2)c1N |
| InChI | InChI=1S/C20H19NO/c1-14-8-9-15(2)20(21)19(14)16-10-12-18(13-11-16)22-17-6-4-3-5-7-17/h3-13H,21H2,1-2H3 |
| InChIKey | CUMNAXXOAGNFRB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|