C22H23N5O5 — CID 173277836
acetic acid;3-[1-(3-aminopropyl)-2-methylindol-3-yl]-7-nitro-1H-quinoxalin-2-one (PubChem CID 173277836) has the molecular formula C22H23N5O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is acetic acid;3-[1-(3-aminopropyl)-2-methylindol-3-yl]-7-nitro-1H-quinoxalin-2-one.
| Compound Name | acetic acid;3-[1-(3-aminopropyl)-2-methylindol-3-yl]-7-nitro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 173277836 |
| Molecular Formula | C22H23N5O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | acetic acid;3-[1-(3-aminopropyl)-2-methylindol-3-yl]-7-nitro-1H-quinoxalin-2-one |
| SMILES | CC(=O)O.Cc1c(-c2nc3ccc([N+](=O)[O-])cc3[nH]c2=O)c2ccccc2n1CCCN |
| InChI | InChI=1S/C20H19N5O3.C2H4O2/c1-12-18(14-5-2-3-6-17(14)24(12)10-4-9-21)19-20(26)23-16-11-13(25(27)28)7-8-15(16)22-19;1-2(3)4/h2-3,5-8,11H,4,9-10,21H2,1H3,(H,23,26);1H3,(H,3,4) |
| InChIKey | MKRIEFXMBLHSIX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|