About acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one
acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one (PubChem CID 173277698) has the molecular formula C21H21N5O5
and a molecular weight of 423.43 g/mol. Its IUPAC name is acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one |
| PubChem CID | 173277698 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one |
| SMILES | CC(=O)O.NCCCn1cc(-c2nc3ccc([N+](=O)[O-])cc3[nH]c2=O)c2ccccc21 |
| InChI | InChI=1S/C19H17N5O3.C2H4O2/c20-8-3-9-23-11-14(13-4-1-2-5-17(13)23)18-19(25)22-16-10-12(24(26)27)6-7-15(16)21-18;1-2(3)4/h1-2,4-7,10-11H,3,8-9,20H2,(H,22,25);1H3,(H,3,4) |
| InChIKey | BSKBOIFQWFBXOA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one?
The IUPAC name of acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one (CID 173277698) is acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one.
What is the SMILES notation for acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one?
The canonical SMILES for acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one is CC(=O)O.NCCCn1cc(-c2nc3ccc([N+](=O)[O-])cc3[nH]c2=O)c2ccccc21.
What is the InChIKey of acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one?
The InChIKey is BSKBOIFQWFBXOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O3.C2H4O2/c20-8-3-9-23-11-14(13-4-1-2-5-17(13)23)18-19(25)22-16-10-12(24(26)27)6-7-15(16)21-18;1-2(3)4/h1-2,4-7,10-11H,3,8-9,20H2,(H,22,25);1H3,(H,3,4).
What are the key properties of acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one?
acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one has a molecular weight of 423.43 g/mol, XLogP of 2.89, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-[1-(3-aminopropyl)indol-3-yl]-7-nitro-1H-quinoxalin-2-one is sourced from PubChem (CID 173277698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).