C20H18N6O — CID 18419255
7-[1-(3-aminopropyl)indol-3-yl]-1,5-dihydroimidazo[4,5-g]quinoxalin-6-one (PubChem CID 18419255) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is 7-[1-(3-aminopropyl)indol-3-yl]-1,5-dihydroimidazo[4,5-g]quinoxalin-6-one.
| Compound Name | 7-[1-(3-aminopropyl)indol-3-yl]-1,5-dihydroimidazo[4,5-g]quinoxalin-6-one |
|---|---|
| PubChem CID | 18419255 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 7-[1-(3-aminopropyl)indol-3-yl]-1,5-dihydroimidazo[4,5-g]quinoxalin-6-one |
| SMILES | NCCCn1cc(-c2nc3cc4[nH]cnc4cc3[nH]c2=O)c2ccccc21 |
| InChI | InChI=1S/C20H18N6O/c21-6-3-7-26-10-13(12-4-1-2-5-18(12)26)19-20(27)25-17-9-15-14(22-11-23-15)8-16(17)24-19/h1-2,4-5,8-11H,3,6-7,21H2,(H,22,23)(H,25,27) |
| InChIKey | LOTSMKVQHHLMJB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |