C22H22N4O3 — CID 18419223
9-[1-(4-aminobutyl)indol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one (PubChem CID 18419223) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is 9-[1-(4-aminobutyl)indol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one.
| Compound Name | 9-[1-(4-aminobutyl)indol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one |
|---|---|
| PubChem CID | 18419223 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 9-[1-(4-aminobutyl)indol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one |
| SMILES | NCCCCn1cc(-c2nc3c4c(ccc3[nH]c2=O)OCCO4)c2ccccc21 |
| InChI | InChI=1S/C22H22N4O3/c23-9-3-4-10-26-13-15(14-5-1-2-6-17(14)26)19-22(27)24-16-7-8-18-21(20(16)25-19)29-12-11-28-18/h1-2,5-8,13H,3-4,9-12,23H2,(H,24,27) |
| InChIKey | SXHGKXPCXIKZKG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|