C31H32N4O5 — CID 18419095
acetic acid;9-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one (PubChem CID 18419095) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is acetic acid;9-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one.
| Compound Name | acetic acid;9-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one |
|---|---|
| PubChem CID | 18419095 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | acetic acid;9-[1-(4-aminobutyl)-2-benzylindol-3-yl]-3,7-dihydro-2H-[1,4]dioxino[2,3-f]quinoxalin-8-one |
| SMILES | CC(=O)O.NCCCCn1c(Cc2ccccc2)c(-c2nc3c4c(ccc3[nH]c2=O)OCCO4)c2ccccc21 |
| InChI | InChI=1S/C29H28N4O3.C2H4O2/c30-14-6-7-15-33-22-11-5-4-10-20(22)25(23(33)18-19-8-2-1-3-9-19)27-29(34)31-21-12-13-24-28(26(21)32-27)36-17-16-35-24;1-2(3)4/h1-5,8-13H,6-7,14-18,30H2,(H,31,34);1H3,(H,3,4) |
| InChIKey | CGHVGHWLYZLMEK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|