C29H30N4O3 — CID 67565739
acetic acid;3-[1-(3-aminopropyl)-2-ethylindol-3-yl]-7-phenyl-1H-quinoxalin-2-one (PubChem CID 67565739) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is acetic acid;3-[1-(3-aminopropyl)-2-ethylindol-3-yl]-7-phenyl-1H-quinoxalin-2-one.
| Compound Name | acetic acid;3-[1-(3-aminopropyl)-2-ethylindol-3-yl]-7-phenyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 67565739 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | acetic acid;3-[1-(3-aminopropyl)-2-ethylindol-3-yl]-7-phenyl-1H-quinoxalin-2-one |
| SMILES | CC(=O)O.CCc1c(-c2nc3ccc(-c4ccccc4)cc3[nH]c2=O)c2ccccc2n1CCCN |
| InChI | InChI=1S/C27H26N4O.C2H4O2/c1-2-23-25(20-11-6-7-12-24(20)31(23)16-8-15-28)26-27(32)30-22-17-19(13-14-21(22)29-26)18-9-4-3-5-10-18;1-2(3)4/h3-7,9-14,17H,2,8,15-16,28H2,1H3,(H,30,32);1H3,(H,3,4) |
| InChIKey | RTOZTENABYOOFV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |