C35H32N4O3 — CID 67610228
[3-[1-(4-aminobutyl)-2-benzylindol-3-yl]-2-oxo-7-phenylquinoxalin-1-yl] acetate (PubChem CID 67610228) has the molecular formula C35H32N4O3 and a molecular weight of 556.67 g/mol. Its IUPAC name is [3-[1-(4-aminobutyl)-2-benzylindol-3-yl]-2-oxo-7-phenylquinoxalin-1-yl] acetate.
| Compound Name | [3-[1-(4-aminobutyl)-2-benzylindol-3-yl]-2-oxo-7-phenylquinoxalin-1-yl] acetate |
|---|---|
| PubChem CID | 67610228 |
| Molecular Formula | C35H32N4O3 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | [3-[1-(4-aminobutyl)-2-benzylindol-3-yl]-2-oxo-7-phenylquinoxalin-1-yl] acetate |
| SMILES | CC(=O)On1c(=O)c(-c2c(Cc3ccccc3)n(CCCCN)c3ccccc23)nc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C35H32N4O3/c1-24(40)42-39-31-23-27(26-14-6-3-7-15-26)18-19-29(31)37-34(35(39)41)33-28-16-8-9-17-30(28)38(21-11-10-20-36)32(33)22-25-12-4-2-5-13-25/h2-9,12-19,23H,10-11,20-22,36H2,1H3 |
| InChIKey | RYJIHRXSJNHDST-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|