C25H26N4O5 — CID 18419203
acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one (PubChem CID 18419203) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one.
| Compound Name | acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one |
|---|---|
| PubChem CID | 18419203 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one |
| SMILES | CC(=O)O.NCCCn1cc(-c2nc3cc4c(cc3[nH]c2=O)CCC4)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C23H22N4O3.C2H4O2/c24-5-2-6-27-11-16(15-9-20-21(10-19(15)27)30-12-29-20)22-23(28)26-18-8-14-4-1-3-13(14)7-17(18)25-22;1-2(3)4/h7-11H,1-6,12,24H2,(H,26,28);1H3,(H,3,4) |
| InChIKey | ZRVJVUZDPPGPMW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |