C15H22N2 — CID 173284088
4-[2,6-di(propan-2-yl)phenyl]-2,5-dihydro-1H-imidazole (PubChem CID 173284088) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 4-[2,6-di(propan-2-yl)phenyl]-2,5-dihydro-1H-imidazole.
| Compound Name | 4-[2,6-di(propan-2-yl)phenyl]-2,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 173284088 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 4-[2,6-di(propan-2-yl)phenyl]-2,5-dihydro-1H-imidazole |
| SMILES | CC(C)c1cccc(C(C)C)c1C1=NCNC1 |
| InChI | InChI=1S/C15H22N2/c1-10(2)12-6-5-7-13(11(3)4)15(12)14-8-16-9-17-14/h5-7,10-11,16H,8-9H2,1-4H3 |
| InChIKey | KRBGJIAGVCESDX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |