C18H35NSn2 — CID 177439563
2,6-di(propan-2-yl)-N,N-bis(trimethylstannyl)aniline (PubChem CID 177439563) has the molecular formula C18H35NSn2 and a molecular weight of 502.91 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-N,N-bis(trimethylstannyl)aniline.
| Compound Name | 2,6-di(propan-2-yl)-N,N-bis(trimethylstannyl)aniline |
|---|---|
| PubChem CID | 177439563 |
| Molecular Formula | C18H35NSn2 |
| Molecular Weight | 502.91 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 2,6-di(propan-2-yl)-N,N-bis(trimethylstannyl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1N([Sn](C)(C)C)[Sn](C)(C)C |
| InChI | InChI=1S/C12H17N.6CH3.2Sn/c1-8(2)10-6-5-7-11(9(3)4)12(10)13;;;;;;;;/h5-9H,1-4H3;6*1H3;; |
| InChIKey | HVMMRTIZCHKGJA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.91 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |