C32H56N2Si2 — CID 22251744
N,N'-bis[2,6-di(propan-2-yl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine (PubChem CID 22251744) has the molecular formula C32H56N2Si2 and a molecular weight of 524.99 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 22251744 |
| Molecular Formula | C32H56N2Si2 |
| Molecular Weight | 524.99 g/mol |
| Exact Mass | 524.40 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]-N,N'-bis(trimethylsilyl)ethane-1,2-diamine |
| SMILES | CC(C)c1cccc(C(C)C)c1N(CCN(c1c(C(C)C)cccc1C(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C32H56N2Si2/c1-23(2)27-17-15-18-28(24(3)4)31(27)33(35(9,10)11)21-22-34(36(12,13)14)32-29(25(5)6)19-16-20-30(32)26(7)8/h15-20,23-26H,21-22H2,1-14H3 |
| InChIKey | FIHZUUVUUVBVIB-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.99 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|