C21H31NSi — CID 139101790
N-(cyclopenta-2,4-dien-1-ylidenemethyl)-2,6-di(propan-2-yl)-N-trimethylsilylaniline (PubChem CID 139101790) has the molecular formula C21H31NSi and a molecular weight of 325.57 g/mol. Its IUPAC name is N-(cyclopenta-2,4-dien-1-ylidenemethyl)-2,6-di(propan-2-yl)-N-trimethylsilylaniline.
| Compound Name | N-(cyclopenta-2,4-dien-1-ylidenemethyl)-2,6-di(propan-2-yl)-N-trimethylsilylaniline |
|---|---|
| PubChem CID | 139101790 |
| Molecular Formula | C21H31NSi |
| Molecular Weight | 325.57 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | N-(cyclopenta-2,4-dien-1-ylidenemethyl)-2,6-di(propan-2-yl)-N-trimethylsilylaniline |
| SMILES | CC(C)c1cccc(C(C)C)c1N(C=C1C=CC=C1)[Si](C)(C)C |
| InChI | InChI=1S/C21H31NSi/c1-16(2)19-13-10-14-20(17(3)4)21(19)22(23(5,6)7)15-18-11-8-9-12-18/h8-17H,1-7H3 |
| InChIKey | RCKQDHSYTDRYSA-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|