C18H35NO3Si2 — CID 155643183
2,6-di(propan-2-yl)-N-trimethoxysilyl-N-trimethylsilylaniline (PubChem CID 155643183) has the molecular formula C18H35NO3Si2 and a molecular weight of 369.65 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-N-trimethoxysilyl-N-trimethylsilylaniline.
| Compound Name | 2,6-di(propan-2-yl)-N-trimethoxysilyl-N-trimethylsilylaniline |
|---|---|
| PubChem CID | 155643183 |
| Molecular Formula | C18H35NO3Si2 |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 2,6-di(propan-2-yl)-N-trimethoxysilyl-N-trimethylsilylaniline |
| SMILES | CO[Si](OC)(OC)N(c1c(C(C)C)cccc1C(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H35NO3Si2/c1-14(2)16-12-11-13-17(15(3)4)18(16)19(23(8,9)10)24(20-5,21-6)22-7/h11-15H,1-10H3 |
| InChIKey | ZOBBGUHXVYFYKW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|