C20H36N2O3 — CID 173299756
N,N-dimethyl-3-phenyldodecan-2-amine;nitric acid (PubChem CID 173299756) has the molecular formula C20H36N2O3 and a molecular weight of 352.52 g/mol. Its IUPAC name is N,N-dimethyl-3-phenyldodecan-2-amine;nitric acid.
| Compound Name | N,N-dimethyl-3-phenyldodecan-2-amine;nitric acid |
|---|---|
| PubChem CID | 173299756 |
| Molecular Formula | C20H36N2O3 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.27 |
| IUPAC Name | N,N-dimethyl-3-phenyldodecan-2-amine;nitric acid |
| SMILES | CCCCCCCCCC(c1ccccc1)C(C)N(C)C.O=[N+]([O-])O |
| InChI | InChI=1S/C20H35N.HNO3/c1-5-6-7-8-9-10-14-17-20(18(2)21(3)4)19-15-12-11-13-16-19;2-1(3)4/h11-13,15-16,18,20H,5-10,14,17H2,1-4H3;(H,2,3,4) |
| InChIKey | SASFURLSXBLNPP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|