C24H28N2O6S — CID 173304207
(2S)-N-hydroxy-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]-3-oxopropanamide (PubChem CID 173304207) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]-3-oxopropanamide.
| Compound Name | (2S)-N-hydroxy-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]-3-oxopropanamide |
|---|---|
| PubChem CID | 173304207 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (2S)-N-hydroxy-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonyl-[2-[(2-methylpropan-2-yl)oxy]ethyl]amino]-3-oxopropanamide |
| SMILES | Cc1ccc(C#Cc2ccc(S(=O)(=O)N(CCOC(C)(C)C)[C@@H](C=O)C(=O)NO)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O6S/c1-18-5-7-19(8-6-18)9-10-20-11-13-21(14-12-20)33(30,31)26(15-16-32-24(2,3)4)22(17-27)23(28)25-29/h5-8,11-14,17,22,29H,15-16H2,1-4H3,(H,25,28)/t22-/m0/s1 |
| InChIKey | KQUWIRLIOANABE-QFIPXVFZSA-N |
| XLogP | 2.27 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|