C15H18N2O5S — CID 173304278
(2S)-N-hydroxy-2-[methyl-(4-pent-1-ynylphenyl)sulfonylamino]-3-oxopropanamide (PubChem CID 173304278) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is (2S)-N-hydroxy-2-[methyl-(4-pent-1-ynylphenyl)sulfonylamino]-3-oxopropanamide.
| Compound Name | (2S)-N-hydroxy-2-[methyl-(4-pent-1-ynylphenyl)sulfonylamino]-3-oxopropanamide |
|---|---|
| PubChem CID | 173304278 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2S)-N-hydroxy-2-[methyl-(4-pent-1-ynylphenyl)sulfonylamino]-3-oxopropanamide |
| SMILES | CCCC#Cc1ccc(S(=O)(=O)N(C)[C@@H](C=O)C(=O)NO)cc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-3-4-5-6-12-7-9-13(10-8-12)23(21,22)17(2)14(11-18)15(19)16-20/h7-11,14,20H,3-4H2,1-2H3,(H,16,19)/t14-/m0/s1 |
| InChIKey | UBVKWWCASNXFTO-AWEZNQCLSA-N |
| XLogP | 0.53 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|