C3H7ClLiNO5 — CID 173306596
lithium;N,N-dimethylformamide;perchlorate (PubChem CID 173306596) has the molecular formula C3H7ClLiNO5 and a molecular weight of 179.48 g/mol. Its IUPAC name is lithium;N,N-dimethylformamide;perchlorate.
| Compound Name | lithium;N,N-dimethylformamide;perchlorate |
|---|---|
| PubChem CID | 173306596 |
| Molecular Formula | C3H7ClLiNO5 |
| Molecular Weight | 179.48 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | lithium;N,N-dimethylformamide;perchlorate |
| SMILES | CN(C)C=O.[Li+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C3H7NO.ClHO4.Li/c1-4(2)3-5;2-1(3,4)5;/h3H,1-2H3;(H,2,3,4,5);/q;;+1/p-1 |
| InChIKey | FUCNVNXRSMVDNU-UHFFFAOYSA-M |
| XLogP | -8.05 |
| TPSA | 112.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.48 |
| LogP ≤ 5 | -8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|