C9H22Si — CID 173314466
tris(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)silane (PubChem CID 173314466) has the molecular formula C9H22Si and a molecular weight of 179.49 g/mol. Its IUPAC name is tris(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)silane.
| Compound Name | tris(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)silane |
|---|---|
| PubChem CID | 173314466 |
| Molecular Formula | C9H22Si |
| Molecular Weight | 179.49 g/mol |
| Exact Mass | 179.28 |
| IUPAC Name | tris(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)silane |
| SMILES | [2H]C([2H])([2H])C([2H])([SiH](C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C9H22Si/c1-7(2)10(8(3)4)9(5)6/h7-10H,1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3,7D,8D,9D |
| InChIKey | YDJXDYKQMRNUSA-HLTYWXIHSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|